C35H46Cl3N3O4 — CID 70099420
ethyl 4-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]imino-4-ethoxybutanoate;dihydrochloride (PubChem CID 70099420) has the molecular formula C35H46Cl3N3O4 and a molecular weight of 679.13 g/mol. Its IUPAC name is ethyl 4-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]imino-4-ethoxybutanoate;dihydrochloride.
| Compound Name | ethyl 4-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]imino-4-ethoxybutanoate;dihydrochloride |
|---|---|
| PubChem CID | 70099420 |
| Molecular Formula | C35H46Cl3N3O4 |
| Molecular Weight | 679.13 g/mol |
| Exact Mass | 677.26 |
| IUPAC Name | ethyl 4-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]imino-4-ethoxybutanoate;dihydrochloride |
| SMILES | CCOC(=O)CC/C(=N/CC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccn1)OCC.Cl.Cl |
| InChI | InChI=1S/C35H44ClN3O4.2ClH/c1-3-42-32(18-19-33(40)43-4-2)38-27-34(28-11-6-5-7-12-28,31-13-8-9-23-37-31)20-10-24-39-25-21-35(41,22-26-39)29-14-16-30(36)17-15-29;;/h5-9,11-17,23,41H,3-4,10,18-22,24-27H2,1-2H3;2*1H/b38-32-;; |
| InChIKey | IRFQZKPVJNXJEL-NIWKJDGNSA-N |
| XLogP | 7.41 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.13 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|