C23H29NO2 — CID 70474069
2-(2-ethylphenyl)-2-phenyl-4-piperidin-1-ylbutanoic acid (PubChem CID 70474069) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-2-phenyl-4-piperidin-1-ylbutanoic acid.
| Compound Name | 2-(2-ethylphenyl)-2-phenyl-4-piperidin-1-ylbutanoic acid |
|---|---|
| PubChem CID | 70474069 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-(2-ethylphenyl)-2-phenyl-4-piperidin-1-ylbutanoic acid |
| SMILES | CCc1ccccc1C(CCN1CCCCC1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-2-19-11-7-8-14-21(19)23(22(25)26,20-12-5-3-6-13-20)15-18-24-16-9-4-10-17-24/h3,5-8,11-14H,2,4,9-10,15-18H2,1H3,(H,25,26) |
| InChIKey | BJPBTNRMHAMKFJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |