C20H25NO — CID 163322578
1-(2,3,4,5,6-pentadeuteriophenyl)-1-phenyl-3-piperidin-1-ylpropan-1-ol (PubChem CID 163322578) has the molecular formula C20H25NO and a molecular weight of 300.46 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentadeuteriophenyl)-1-phenyl-3-piperidin-1-ylpropan-1-ol.
| Compound Name | 1-(2,3,4,5,6-pentadeuteriophenyl)-1-phenyl-3-piperidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 163322578 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-(2,3,4,5,6-pentadeuteriophenyl)-1-phenyl-3-piperidin-1-ylpropan-1-ol |
| SMILES | [2H]c1c([2H])c([2H])c(C(O)(CCN2CCCCC2)c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C20H25NO/c22-20(18-10-4-1-5-11-18,19-12-6-2-7-13-19)14-17-21-15-8-3-9-16-21/h1-2,4-7,10-13,22H,3,8-9,14-17H2/i1D,4D,5D,10D,11D |
| InChIKey | RQXCLMGKHJWMOA-ZWYOJXJXSA-N |
| XLogP | 3.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |