C28H33NO2 — CID 67766742
(5R)-1,1,5-triphenyl-5-piperidin-1-ylpentane-1,5-diol (PubChem CID 67766742) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (5R)-1,1,5-triphenyl-5-piperidin-1-ylpentane-1,5-diol.
| Compound Name | (5R)-1,1,5-triphenyl-5-piperidin-1-ylpentane-1,5-diol |
|---|---|
| PubChem CID | 67766742 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (5R)-1,1,5-triphenyl-5-piperidin-1-ylpentane-1,5-diol |
| SMILES | OC(CCC[C@@](O)(c1ccccc1)N1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO2/c30-27(24-14-5-1-6-15-24,25-16-7-2-8-17-25)20-13-21-28(31,26-18-9-3-10-19-26)29-22-11-4-12-23-29/h1-3,5-10,14-19,30-31H,4,11-13,20-23H2/t28-/m1/s1 |
| InChIKey | BNGRUENIPDHRNE-MUUNZHRXSA-N |
| XLogP | 5.42 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |