C24H33NO — CID 92853218
5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpentan-1-ol (PubChem CID 92853218) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is 5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpentan-1-ol.
| Compound Name | 5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpentan-1-ol |
|---|---|
| PubChem CID | 92853218 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpentan-1-ol |
| SMILES | C[C@H]1CCC[C@H](C)N1CCCCC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO/c1-20-12-11-13-21(2)25(20)19-10-9-18-24(26,22-14-5-3-6-15-22)23-16-7-4-8-17-23/h3-8,14-17,20-21,26H,9-13,18-19H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | KUFREUPVXVHBCT-SFTDATJTSA-N |
| XLogP | 5.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|