C23H32N2O — CID 97356694
(1R)-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylpentan-1-ol (PubChem CID 97356694) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is (1R)-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylpentan-1-ol.
| Compound Name | (1R)-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylpentan-1-ol |
|---|---|
| PubChem CID | 97356694 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | (1R)-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylpentan-1-ol |
| SMILES | C[C@@H]1CCC[C@@H](C)N1CCCC[C@@](O)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C23H32N2O/c1-19-11-10-12-20(2)25(19)18-9-7-16-23(26,21-13-4-3-5-14-21)22-15-6-8-17-24-22/h3-6,8,13-15,17,19-20,26H,7,9-12,16,18H2,1-2H3/t19-,20-,23-/m1/s1 |
| InChIKey | DOMLQNJBAMPKKT-TXTKFYIRSA-N |
| XLogP | 4.75 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|