C22H29NO — CID 92853219
3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpropan-1-ol (PubChem CID 92853219) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpropan-1-ol.
| Compound Name | 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 92853219 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylpropan-1-ol |
| SMILES | C[C@@H]1CCC[C@@H](C)N1CCC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO/c1-18-10-9-11-19(2)23(18)17-16-22(24,20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-8,12-15,18-19,24H,9-11,16-17H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | YWUUDSJJYZRSQL-RTBURBONSA-N |
| XLogP | 4.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |