About 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine
1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine (PubChem CID 142832915) has the molecular formula C22H37N
and a molecular weight of 315.55 g/mol. Its IUPAC name is 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine |
| PubChem CID | 142832915 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine |
| SMILES | CCCC(CC)(CCN1C(C)CCCC1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H37N/c1-6-15-22(7-2,21-13-11-18(3)12-14-21)16-17-23-19(4)9-8-10-20(23)5/h11-14,19-20H,6-10,15-17H2,1-5H3 |
| InChIKey | FHRKMAIBBJQVPF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine?
The IUPAC name of 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine (CID 142832915) is 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine.
What is the SMILES notation for 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine?
The canonical SMILES for 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine is CCCC(CC)(CCN1C(C)CCCC1C)c1ccc(C)cc1.
What is the InChIKey of 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine?
The InChIKey is FHRKMAIBBJQVPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37N/c1-6-15-22(7-2,21-13-11-18(3)12-14-21)16-17-23-19(4)9-8-10-20(23)5/h11-14,19-20H,6-10,15-17H2,1-5H3.
What are the key properties of 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine?
1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine has a molecular weight of 315.55 g/mol, XLogP of 6.10, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-ethyl-3-(4-methylphenyl)hexyl]-2,6-dimethylpiperidine is sourced from PubChem (CID 142832915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).