C22H28N2O — CID 129374512
(E,1S)-4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylbut-2-en-1-ol (PubChem CID 129374512) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (E,1S)-4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylbut-2-en-1-ol.
| Compound Name | (E,1S)-4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylbut-2-en-1-ol |
|---|---|
| PubChem CID | 129374512 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (E,1S)-4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1-phenyl-1-pyridin-2-ylbut-2-en-1-ol |
| SMILES | C[C@@H]1CCC[C@H](C)N1C/C=C/[C@](O)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C22H28N2O/c1-18-10-8-11-19(2)24(18)17-9-15-22(25,20-12-4-3-5-13-20)21-14-6-7-16-23-21/h3-7,9,12-16,18-19,25H,8,10-11,17H2,1-2H3/b15-9+/t18-,19+,22-/m0/s1 |
| InChIKey | YOGCIXBRKGGRLY-UGFLADCKSA-N |
| XLogP | 4.14 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|