C21H26N2O3 — CID 70340569
(2-hydroxy-2-phenyl-2-pyridin-2-ylethyl) (3S)-1-ethylpiperidine-3-carboxylate (PubChem CID 70340569) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2-hydroxy-2-phenyl-2-pyridin-2-ylethyl) (3S)-1-ethylpiperidine-3-carboxylate.
| Compound Name | (2-hydroxy-2-phenyl-2-pyridin-2-ylethyl) (3S)-1-ethylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 70340569 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2-hydroxy-2-phenyl-2-pyridin-2-ylethyl) (3S)-1-ethylpiperidine-3-carboxylate |
| SMILES | CCN1CCC[C@H](C(=O)OCC(O)(c2ccccc2)c2ccccn2)C1 |
| InChI | InChI=1S/C21H26N2O3/c1-2-23-14-8-9-17(15-23)20(24)26-16-21(25,18-10-4-3-5-11-18)19-12-6-7-13-22-19/h3-7,10-13,17,25H,2,8-9,14-16H2,1H3/t17-,21?/m0/s1 |
| InChIKey | VICOJRCGPZXLST-PBVYKCSPSA-N |
| XLogP | 2.59 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |