C27H37AlN4O — CID 164916965
CID 164916965 (PubChem CID 164916965) has the molecular formula C27H37AlN4O and a molecular weight of 460.60 g/mol.
| Compound Name | CID 164916965 |
|---|---|
| PubChem CID | 164916965 |
| Molecular Formula | C27H37AlN4O |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)C(CCN1CCC[C@H]1CN1CCN([Al])CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H37N4O.Al/c1-29(2)26(32)27(23-10-5-3-6-11-23,24-12-7-4-8-13-24)15-19-31-18-9-14-25(31)22-30-20-16-28-17-21-30;/h3-8,10-13,25H,9,14-22H2,1-2H3;/q-1;+1/t25-;/m0./s1 |
| InChIKey | GPLLPXRWPPBYDR-UQIIZPHYSA-N |
| XLogP | 2.62 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |