C24H33N2O+ — CID 3030672
N,N-dimethyl-4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide (PubChem CID 3030672) has the molecular formula C24H33N2O+ and a molecular weight of 365.54 g/mol. Its IUPAC name is N,N-dimethyl-4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide.
| Compound Name | N,N-dimethyl-4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 3030672 |
| Molecular Formula | C24H33N2O+ |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N,N-dimethyl-4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CC[N+]1(C)CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33N2O/c1-25(2)23(27)24(21-13-7-4-8-14-21,22-15-9-5-10-16-22)17-20-26(3)18-11-6-12-19-26/h4-5,7-10,13-16H,6,11-12,17-20H2,1-3H3/q+1 |
| InChIKey | FHYNIQPSSYVSDG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|