C22H30INO4 — CID 21126788
2-hydroxy-2,2-diphenylacetate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;hydroiodide (PubChem CID 21126788) has the molecular formula C22H30INO4 and a molecular weight of 499.39 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenylacetate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;hydroiodide.
| Compound Name | 2-hydroxy-2,2-diphenylacetate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;hydroiodide |
|---|---|
| PubChem CID | 21126788 |
| Molecular Formula | C22H30INO4 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-hydroxy-2,2-diphenylacetate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;hydroiodide |
| SMILES | C[N+]1(CCO)CCCCC1.I.O=C([O-])C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3.C8H18NO.HI/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-9(7-8-10)5-3-2-4-6-9;/h1-10,17H,(H,15,16);10H,2-8H2,1H3;1H/q;+1;/p-1 |
| InChIKey | BPHADGUDXHKMQY-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|