C23H31N2O+ — CID 3031579
2,2-diphenyl-4-(1-propan-2-ylpyrrolidin-1-ium-1-yl)butanamide (PubChem CID 3031579) has the molecular formula C23H31N2O+ and a molecular weight of 351.51 g/mol. Its IUPAC name is 2,2-diphenyl-4-(1-propan-2-ylpyrrolidin-1-ium-1-yl)butanamide.
| Compound Name | 2,2-diphenyl-4-(1-propan-2-ylpyrrolidin-1-ium-1-yl)butanamide |
|---|---|
| PubChem CID | 3031579 |
| Molecular Formula | C23H31N2O+ |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2,2-diphenyl-4-(1-propan-2-ylpyrrolidin-1-ium-1-yl)butanamide |
| SMILES | CC(C)[N+]1(CCC(C(N)=O)(c2ccccc2)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C23H30N2O/c1-19(2)25(16-9-10-17-25)18-15-23(22(24)26,20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-8,11-14,19H,9-10,15-18H2,1-2H3,(H-,24,26)/p+1 |
| InChIKey | WIIYQYZDOOSCEP-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|