C23H33BrN2O — CID 3026418
(4-amino-4-oxo-3,3-diphenylbutyl)-diethyl-propan-2-ylazanium bromide (PubChem CID 3026418) has the molecular formula C23H33BrN2O and a molecular weight of 433.43 g/mol. Its IUPAC name is (4-amino-4-oxo-3,3-diphenylbutyl)-diethyl-propan-2-ylazanium bromide.
| Compound Name | (4-amino-4-oxo-3,3-diphenylbutyl)-diethyl-propan-2-ylazanium bromide |
|---|---|
| PubChem CID | 3026418 |
| Molecular Formula | C23H33BrN2O |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (4-amino-4-oxo-3,3-diphenylbutyl)-diethyl-propan-2-ylazanium bromide |
| SMILES | CC[N+](CC)(CCC(C(N)=O)(c1ccccc1)c1ccccc1)C(C)C.[Br-] |
| InChI | InChI=1S/C23H32N2O.BrH/c1-5-25(6-2,19(3)4)18-17-23(22(24)26,20-13-9-7-10-14-20)21-15-11-8-12-16-21;/h7-16,19H,5-6,17-18H2,1-4H3,(H-,24,26);1H |
| InChIKey | YPMKJPNGGDEZMM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|