C21H24N2O5 — CID 20556756
2-[(5-amino-5-oxo-4,4-diphenylpentyl)-(carboxymethyl)amino]acetic acid (PubChem CID 20556756) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[(5-amino-5-oxo-4,4-diphenylpentyl)-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[(5-amino-5-oxo-4,4-diphenylpentyl)-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 20556756 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[(5-amino-5-oxo-4,4-diphenylpentyl)-(carboxymethyl)amino]acetic acid |
| SMILES | NC(=O)C(CCCN(CC(=O)O)CC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O5/c22-20(28)21(16-8-3-1-4-9-16,17-10-5-2-6-11-17)12-7-13-23(14-18(24)25)15-19(26)27/h1-6,8-11H,7,12-15H2,(H2,22,28)(H,24,25)(H,26,27) |
| InChIKey | UTPTYKMSMVZHGQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |