C26H30N2O — CID 19088491
4-[methyl(3-phenylpropyl)amino]-2,2-diphenylbutanamide (PubChem CID 19088491) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is 4-[methyl(3-phenylpropyl)amino]-2,2-diphenylbutanamide.
| Compound Name | 4-[methyl(3-phenylpropyl)amino]-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 19088491 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-[methyl(3-phenylpropyl)amino]-2,2-diphenylbutanamide |
| SMILES | CN(CCCc1ccccc1)CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O/c1-28(20-11-14-22-12-5-2-6-13-22)21-19-26(25(27)29,23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-10,12-13,15-18H,11,14,19-21H2,1H3,(H2,27,29) |
| InChIKey | KCSIEDJDAWWAEJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |