C26H30N3O3S- — CID 19088481
1-[2-[(5-amino-5-oxo-4,4-diphenylpentyl)-methylamino]ethyl]-4-(sulfinatoamino)benzene (PubChem CID 19088481) has the molecular formula C26H30N3O3S- and a molecular weight of 464.61 g/mol. Its IUPAC name is 1-[2-[(5-amino-5-oxo-4,4-diphenylpentyl)-methylamino]ethyl]-4-(sulfinatoamino)benzene.
| Compound Name | 1-[2-[(5-amino-5-oxo-4,4-diphenylpentyl)-methylamino]ethyl]-4-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 19088481 |
| Molecular Formula | C26H30N3O3S- |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[2-[(5-amino-5-oxo-4,4-diphenylpentyl)-methylamino]ethyl]-4-(sulfinatoamino)benzene |
| SMILES | CN(CCCC(C(N)=O)(c1ccccc1)c1ccccc1)CCc1ccc(NS(=O)[O-])cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-29(20-17-21-13-15-24(16-14-21)28-33(31)32)19-8-18-26(25(27)30,22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-7,9-16,28H,8,17-20H2,1H3,(H2,27,30)(H,31,32)/p-1 |
| InChIKey | TXSGJKUUEGVMEA-UHFFFAOYSA-M |
| XLogP | 3.62 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|