C27H32N2O2 — CID 19088507
5-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-diphenylpentanamide (PubChem CID 19088507) has the molecular formula C27H32N2O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-diphenylpentanamide.
| Compound Name | 5-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-diphenylpentanamide |
|---|---|
| PubChem CID | 19088507 |
| Molecular Formula | C27H32N2O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethyl-methylamino]-2,2-diphenylpentanamide |
| SMILES | COc1ccc(CCN(C)CCCC(C(N)=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N2O2/c1-29(21-18-22-14-16-25(31-2)17-15-22)20-9-19-27(26(28)30,23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-17H,9,18-21H2,1-2H3,(H2,28,30) |
| InChIKey | FVKPBVWPTAATEI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |