C19H24N2O3 — CID 57275546
5-(dimethylamino)-2,2-bis(4-hydroxyphenyl)pentanamide (PubChem CID 57275546) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-(dimethylamino)-2,2-bis(4-hydroxyphenyl)pentanamide.
| Compound Name | 5-(dimethylamino)-2,2-bis(4-hydroxyphenyl)pentanamide |
|---|---|
| PubChem CID | 57275546 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-(dimethylamino)-2,2-bis(4-hydroxyphenyl)pentanamide |
| SMILES | CN(C)CCCC(C(N)=O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-21(2)13-3-12-19(18(20)24,14-4-8-16(22)9-5-14)15-6-10-17(23)11-7-15/h4-11,22-23H,3,12-13H2,1-2H3,(H2,20,24) |
| InChIKey | KKWJMPODZLUGOD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |