C20H24O4 — CID 139611128
propyl 2,2-bis(4-hydroxyphenyl)pentanoate (PubChem CID 139611128) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is propyl 2,2-bis(4-hydroxyphenyl)pentanoate.
| Compound Name | propyl 2,2-bis(4-hydroxyphenyl)pentanoate |
|---|---|
| PubChem CID | 139611128 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | propyl 2,2-bis(4-hydroxyphenyl)pentanoate |
| SMILES | CCCOC(=O)C(CCC)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H24O4/c1-3-13-20(19(23)24-14-4-2,15-5-9-17(21)10-6-15)16-7-11-18(22)12-8-16/h5-12,21-22H,3-4,13-14H2,1-2H3 |
| InChIKey | QBAYFTSKHCUSGF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |