C14H19NO5 — CID 68730894
1-O-butyl 3-O-methyl 2-amino-2-(4-hydroxyphenyl)propanedioate (PubChem CID 68730894) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-O-butyl 3-O-methyl 2-amino-2-(4-hydroxyphenyl)propanedioate.
| Compound Name | 1-O-butyl 3-O-methyl 2-amino-2-(4-hydroxyphenyl)propanedioate |
|---|---|
| PubChem CID | 68730894 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-O-butyl 3-O-methyl 2-amino-2-(4-hydroxyphenyl)propanedioate |
| SMILES | CCCCOC(=O)C(N)(C(=O)OC)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H19NO5/c1-3-4-9-20-13(18)14(15,12(17)19-2)10-5-7-11(16)8-6-10/h5-8,16H,3-4,9,15H2,1-2H3 |
| InChIKey | YYQKUGMOPOVEIP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|