C11H15NO4S — CID 69325181
(2R)-2-amino-3-butoxy-3-oxo-2-thiophen-2-ylpropanoic acid (PubChem CID 69325181) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is (2R)-2-amino-3-butoxy-3-oxo-2-thiophen-2-ylpropanoic acid.
| Compound Name | (2R)-2-amino-3-butoxy-3-oxo-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 69325181 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (2R)-2-amino-3-butoxy-3-oxo-2-thiophen-2-ylpropanoic acid |
| SMILES | CCCCOC(=O)[C@](N)(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C11H15NO4S/c1-2-3-6-16-10(15)11(12,9(13)14)8-5-4-7-17-8/h4-5,7H,2-3,6,12H2,1H3,(H,13,14)/t11-/m1/s1 |
| InChIKey | QGHHWPNKGMTZMA-LLVKDONJSA-N |
| XLogP | 1.33 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|