C21H24O6 — CID 68957715
2,2-bis(4-hydroxyphenyl)nonanedioic acid (PubChem CID 68957715) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2,2-bis(4-hydroxyphenyl)nonanedioic acid.
| Compound Name | 2,2-bis(4-hydroxyphenyl)nonanedioic acid |
|---|---|
| PubChem CID | 68957715 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2,2-bis(4-hydroxyphenyl)nonanedioic acid |
| SMILES | O=C(O)CCCCCCC(C(=O)O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H24O6/c22-17-10-6-15(7-11-17)21(20(26)27,16-8-12-18(23)13-9-16)14-4-2-1-3-5-19(24)25/h6-13,22-23H,1-5,14H2,(H,24,25)(H,26,27) |
| InChIKey | HUAUSRBJWRPBBE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|