C24H33N3O5 — CID 57280163
5-(diethylamino)-2-[4-(dimethylaminocarbamoyloxy)phenyl]-2-(4-hydroxyphenyl)pentanoic acid (PubChem CID 57280163) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is 5-(diethylamino)-2-[4-(dimethylaminocarbamoyloxy)phenyl]-2-(4-hydroxyphenyl)pentanoic acid.
| Compound Name | 5-(diethylamino)-2-[4-(dimethylaminocarbamoyloxy)phenyl]-2-(4-hydroxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 57280163 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 5-(diethylamino)-2-[4-(dimethylaminocarbamoyloxy)phenyl]-2-(4-hydroxyphenyl)pentanoic acid |
| SMILES | CCN(CC)CCCC(C(=O)O)(c1ccc(O)cc1)c1ccc(OC(=O)NN(C)C)cc1 |
| InChI | InChI=1S/C24H33N3O5/c1-5-27(6-2)17-7-16-24(22(29)30,18-8-12-20(28)13-9-18)19-10-14-21(15-11-19)32-23(31)25-26(3)4/h8-15,28H,5-7,16-17H2,1-4H3,(H,25,31)(H,29,30) |
| InChIKey | IRJIJRBAAXROEK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|