C22H35NO3 — CID 24805079
phenyl 2-cyclohexyl-6-(diethylamino)-2-hydroxyhexanoate (PubChem CID 24805079) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is phenyl 2-cyclohexyl-6-(diethylamino)-2-hydroxyhexanoate.
| Compound Name | phenyl 2-cyclohexyl-6-(diethylamino)-2-hydroxyhexanoate |
|---|---|
| PubChem CID | 24805079 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | phenyl 2-cyclohexyl-6-(diethylamino)-2-hydroxyhexanoate |
| SMILES | CCN(CC)CCCCC(O)(C(=O)Oc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H35NO3/c1-3-23(4-2)18-12-11-17-22(25,19-13-7-5-8-14-19)21(24)26-20-15-9-6-10-16-20/h6,9-10,15-16,19,25H,3-5,7-8,11-14,17-18H2,1-2H3 |
| InChIKey | HLJXZQSJPLLBLW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|