C22H34INO — CID 126477733
1-cyclohexyl-5-(diethylamino)-1-phenylpent-2-yn-1-ol;iodomethane (PubChem CID 126477733) has the molecular formula C22H34INO and a molecular weight of 455.42 g/mol. Its IUPAC name is 1-cyclohexyl-5-(diethylamino)-1-phenylpent-2-yn-1-ol;iodomethane.
| Compound Name | 1-cyclohexyl-5-(diethylamino)-1-phenylpent-2-yn-1-ol;iodomethane |
|---|---|
| PubChem CID | 126477733 |
| Molecular Formula | C22H34INO |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 1-cyclohexyl-5-(diethylamino)-1-phenylpent-2-yn-1-ol;iodomethane |
| SMILES | CCN(CC)CCC#CC(O)(c1ccccc1)C1CCCCC1.CI |
| InChI | InChI=1S/C21H31NO.CH3I/c1-3-22(4-2)18-12-11-17-21(23,19-13-7-5-8-14-19)20-15-9-6-10-16-20;1-2/h5,7-8,13-14,20,23H,3-4,6,9-10,12,15-16,18H2,1-2H3;1H3 |
| InChIKey | LBSQOFLTZSZXHA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|