C21H32NO+ — CID 6996794
[(4R)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]-ethyl-methyl-propan-2-ylazanium (PubChem CID 6996794) has the molecular formula C21H32NO+ and a molecular weight of 314.49 g/mol. Its IUPAC name is [(4R)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]-ethyl-methyl-propan-2-ylazanium.
| Compound Name | [(4R)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]-ethyl-methyl-propan-2-ylazanium |
|---|---|
| PubChem CID | 6996794 |
| Molecular Formula | C21H32NO+ |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | [(4R)-4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl]-ethyl-methyl-propan-2-ylazanium |
| SMILES | CC[N+](C)(CC#C[C@](O)(c1ccccc1)C1CCCC1)C(C)C |
| InChI | InChI=1S/C21H32NO/c1-5-22(4,18(2)3)17-11-16-21(23,20-14-9-10-15-20)19-12-7-6-8-13-19/h6-8,12-13,18,20,23H,5,9-10,14-15,17H2,1-4H3/q+1/t21-,22?/m0/s1 |
| InChIKey | MMJITLAKONISGX-HMTLIYDFSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|