C19H27NO — CID 21148178
1-cyclopentyl-4-(2-methylpropylamino)-1-phenylbut-2-yn-1-ol (PubChem CID 21148178) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-cyclopentyl-4-(2-methylpropylamino)-1-phenylbut-2-yn-1-ol.
| Compound Name | 1-cyclopentyl-4-(2-methylpropylamino)-1-phenylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 21148178 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-cyclopentyl-4-(2-methylpropylamino)-1-phenylbut-2-yn-1-ol |
| SMILES | CC(C)CNCC#CC(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H27NO/c1-16(2)15-20-14-8-13-19(21,18-11-6-7-12-18)17-9-4-3-5-10-17/h3-5,9-10,16,18,20-21H,6-7,11-12,14-15H2,1-2H3 |
| InChIKey | BBPUSBDCOUJGKP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|