C21H30NO+ — CID 3510563
4-(azepan-1-ium-1-yl)-1-cyclopentyl-1-phenylbut-2-yn-1-ol (PubChem CID 3510563) has the molecular formula C21H30NO+ and a molecular weight of 312.48 g/mol. Its IUPAC name is 4-(azepan-1-ium-1-yl)-1-cyclopentyl-1-phenylbut-2-yn-1-ol.
| Compound Name | 4-(azepan-1-ium-1-yl)-1-cyclopentyl-1-phenylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 3510563 |
| Molecular Formula | C21H30NO+ |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 4-(azepan-1-ium-1-yl)-1-cyclopentyl-1-phenylbut-2-yn-1-ol |
| SMILES | OC(C#CC[NH+]1CCCCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C21H29NO/c23-21(20-13-6-7-14-20,19-11-4-3-5-12-19)15-10-18-22-16-8-1-2-9-17-22/h3-5,11-12,20,23H,1-2,6-9,13-14,16-18H2/p+1 |
| InChIKey | UGXGHBWOZDIBTC-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|