C23H28ClNO — CID 44657108
5-(azepan-1-ium-1-yl)-1,1-diphenylpent-3-yn-1-ol chloride (PubChem CID 44657108) has the molecular formula C23H28ClNO and a molecular weight of 369.94 g/mol. Its IUPAC name is 5-(azepan-1-ium-1-yl)-1,1-diphenylpent-3-yn-1-ol chloride.
| Compound Name | 5-(azepan-1-ium-1-yl)-1,1-diphenylpent-3-yn-1-ol chloride |
|---|---|
| PubChem CID | 44657108 |
| Molecular Formula | C23H28ClNO |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 5-(azepan-1-ium-1-yl)-1,1-diphenylpent-3-yn-1-ol chloride |
| SMILES | OC(CC#CC[NH+]1CCCCCC1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C23H27NO.ClH/c25-23(21-13-5-3-6-14-21,22-15-7-4-8-16-22)17-9-12-20-24-18-10-1-2-11-19-24;/h3-8,13-16,25H,1-2,10-11,17-20H2;1H |
| InChIKey | CQZJZOQIGZMHRQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|