C23H30ClNO — CID 44658888
(5-hydroxy-5,5-diphenylpent-2-ynyl)-di(propan-2-yl)azanium chloride (PubChem CID 44658888) has the molecular formula C23H30ClNO and a molecular weight of 371.95 g/mol. Its IUPAC name is (5-hydroxy-5,5-diphenylpent-2-ynyl)-di(propan-2-yl)azanium chloride.
| Compound Name | (5-hydroxy-5,5-diphenylpent-2-ynyl)-di(propan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 44658888 |
| Molecular Formula | C23H30ClNO |
| Molecular Weight | 371.95 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | (5-hydroxy-5,5-diphenylpent-2-ynyl)-di(propan-2-yl)azanium chloride |
| SMILES | CC(C)[NH+](CC#CCC(O)(c1ccccc1)c1ccccc1)C(C)C.[Cl-] |
| InChI | InChI=1S/C23H29NO.ClH/c1-19(2)24(20(3)4)18-12-11-17-23(25,21-13-7-5-8-14-21)22-15-9-6-10-16-22;/h5-10,13-16,19-20,25H,17-18H2,1-4H3;1H |
| InChIKey | DAUNGSBHVAIOIX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.95 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|