C22H28ClN — CID 44657475
5,5-diphenylhex-2-ynyl(diethyl)azanium chloride (PubChem CID 44657475) has the molecular formula C22H28ClN and a molecular weight of 341.93 g/mol. Its IUPAC name is 5,5-diphenylhex-2-ynyl(diethyl)azanium chloride.
| Compound Name | 5,5-diphenylhex-2-ynyl(diethyl)azanium chloride |
|---|---|
| PubChem CID | 44657475 |
| Molecular Formula | C22H28ClN |
| Molecular Weight | 341.93 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5,5-diphenylhex-2-ynyl(diethyl)azanium chloride |
| SMILES | CC[NH+](CC)CC#CCC(C)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H27N.ClH/c1-4-23(5-2)19-13-12-18-22(3,20-14-8-6-9-15-20)21-16-10-7-11-17-21;/h6-11,14-17H,4-5,18-19H2,1-3H3;1H |
| InChIKey | WOLJNABPEMDNLM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.93 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|