C20H26NO2+ — CID 2295241
diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium (PubChem CID 2295241) has the molecular formula C20H26NO2+ and a molecular weight of 312.43 g/mol. Its IUPAC name is diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium.
| Compound Name | diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium |
|---|---|
| PubChem CID | 2295241 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium |
| SMILES | CC[NH+](CC)CCC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-21(4-2)16-15-19(22)20(23,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,23H,3-4,15-16H2,1-2H3/p+1 |
| InChIKey | FCKDCPHGDPVCFH-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |