About diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium
diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium (PubChem CID 2295241) has the molecular formula C20H26NO2+
and a molecular weight of 312.43 g/mol. Its IUPAC name is diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium.
Molecular Properties
| Compound Name | diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium |
| PubChem CID | 2295241 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium |
| SMILES | CC[NH+](CC)CCC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-21(4-2)16-15-19(22)20(23,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,23H,3-4,15-16H2,1-2H3/p+1 |
| InChIKey | FCKDCPHGDPVCFH-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium?
The IUPAC name of diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium (CID 2295241) is diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium.
What is the SMILES notation for diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium?
The canonical SMILES for diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium is CC[NH+](CC)CCC(=O)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium?
The InChIKey is FCKDCPHGDPVCFH-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H25NO2/c1-3-21(4-2)16-15-19(22)20(23,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,23H,3-4,15-16H2,1-2H3/p+1.
What are the key properties of diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium?
diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium has a molecular weight of 312.43 g/mol, XLogP of 1.81, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-(4-hydroxy-3-oxo-4,4-diphenylbutyl)azanium is sourced from PubChem (CID 2295241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).