C20H25ClNO2+ — CID 86308486
2-(2-chloro-2,2-diphenylacetyl)oxyethyl-diethylazanium (PubChem CID 86308486) has the molecular formula C20H25ClNO2+ and a molecular weight of 346.88 g/mol. Its IUPAC name is 2-(2-chloro-2,2-diphenylacetyl)oxyethyl-diethylazanium.
| Compound Name | 2-(2-chloro-2,2-diphenylacetyl)oxyethyl-diethylazanium |
|---|---|
| PubChem CID | 86308486 |
| Molecular Formula | C20H25ClNO2+ |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-(2-chloro-2,2-diphenylacetyl)oxyethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCOC(=O)C(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24ClNO2/c1-3-22(4-2)15-16-24-19(23)20(21,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3/p+1 |
| InChIKey | ZASSLOPXOOJHFR-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|