C18H30ClNO3 — CID 27276
diethyl-[3-(2-hydroxy-3-methyl-2-phenylbutanoyl)oxypropyl]azanium chloride (PubChem CID 27276) has the molecular formula C18H30ClNO3 and a molecular weight of 343.90 g/mol. Its IUPAC name is diethyl-[3-(2-hydroxy-3-methyl-2-phenylbutanoyl)oxypropyl]azanium chloride.
| Compound Name | diethyl-[3-(2-hydroxy-3-methyl-2-phenylbutanoyl)oxypropyl]azanium chloride |
|---|---|
| PubChem CID | 27276 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | diethyl-[3-(2-hydroxy-3-methyl-2-phenylbutanoyl)oxypropyl]azanium chloride |
| SMILES | CC[NH+](CC)CCCOC(=O)C(O)(c1ccccc1)C(C)C.[Cl-] |
| InChI | InChI=1S/C18H29NO3.ClH/c1-5-19(6-2)13-10-14-22-17(20)18(21,15(3)4)16-11-8-7-9-12-16;/h7-9,11-12,15,21H,5-6,10,13-14H2,1-4H3;1H |
| InChIKey | JROFPAJLIMXUII-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|