C22H34O7 — CID 69369162
butanedioic acid;heptyl 2-hydroxy-3-methyl-2-phenylbutanoate (PubChem CID 69369162) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is butanedioic acid;heptyl 2-hydroxy-3-methyl-2-phenylbutanoate.
| Compound Name | butanedioic acid;heptyl 2-hydroxy-3-methyl-2-phenylbutanoate |
|---|---|
| PubChem CID | 69369162 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | butanedioic acid;heptyl 2-hydroxy-3-methyl-2-phenylbutanoate |
| SMILES | CCCCCCCOC(=O)C(O)(c1ccccc1)C(C)C.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C18H28O3.C4H6O4/c1-4-5-6-7-11-14-21-17(19)18(20,15(2)3)16-12-9-8-10-13-16;5-3(6)1-2-4(7)8/h8-10,12-13,15,20H,4-7,11,14H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | XACNPOPLVJYHKC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|