C18H21Cl2NO2 — CID 6451501
2-(dimethylamino)ethyl 2-chloro-2,2-diphenylacetate;hydrochloride (PubChem CID 6451501) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-chloro-2,2-diphenylacetate;hydrochloride.
| Compound Name | 2-(dimethylamino)ethyl 2-chloro-2,2-diphenylacetate;hydrochloride |
|---|---|
| PubChem CID | 6451501 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-chloro-2,2-diphenylacetate;hydrochloride |
| SMILES | CN(C)CCOC(=O)C(Cl)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H20ClNO2.ClH/c1-20(2)13-14-22-17(21)18(19,15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12H,13-14H2,1-2H3;1H |
| InChIKey | XPUAETXQCVNSND-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|