About 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride
2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride (PubChem CID 117068940) has the molecular formula C20H26ClNO2
and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride |
| PubChem CID | 117068940 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride |
| SMILES | CCC(C(=O)OCCN(C)C)c1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25NO2.ClH/c1-4-19(20(22)23-15-14-21(2)3)18-12-10-17(11-13-18)16-8-6-5-7-9-16;/h5-13,19H,4,14-15H2,1-3H3;1H |
| InChIKey | NRIFZVHUMZGITD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride (CID 117068940) is 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride is CCC(C(=O)OCCN(C)C)c1ccc(-c2ccccc2)cc1.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride?
The InChIKey is NRIFZVHUMZGITD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2.ClH/c1-4-19(20(22)23-15-14-21(2)3)18-12-10-17(11-13-18)16-8-6-5-7-9-16;/h5-13,19H,4,14-15H2,1-3H3;1H.
What are the key properties of 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride?
2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride has a molecular weight of 347.89 g/mol, XLogP of 4.37, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-(4-phenylphenyl)butanoate;hydrochloride is sourced from PubChem (CID 117068940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).