C29H25ClO — CID 172999770
1-chloro-1,1,3,3-tetraphenylpentan-2-one (PubChem CID 172999770) has the molecular formula C29H25ClO and a molecular weight of 424.97 g/mol. Its IUPAC name is 1-chloro-1,1,3,3-tetraphenylpentan-2-one.
| Compound Name | 1-chloro-1,1,3,3-tetraphenylpentan-2-one |
|---|---|
| PubChem CID | 172999770 |
| Molecular Formula | C29H25ClO |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 1-chloro-1,1,3,3-tetraphenylpentan-2-one |
| SMILES | CCC(C(=O)C(Cl)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25ClO/c1-2-28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)27(31)29(30,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22H,2H2,1H3 |
| InChIKey | QFBVTEMRLDRXIQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|