C18H22NO2+ — CID 3026595
(3-hydroxy-2-oxo-3,3-diphenylpropyl)-trimethylazanium (PubChem CID 3026595) has the molecular formula C18H22NO2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is (3-hydroxy-2-oxo-3,3-diphenylpropyl)-trimethylazanium.
| Compound Name | (3-hydroxy-2-oxo-3,3-diphenylpropyl)-trimethylazanium |
|---|---|
| PubChem CID | 3026595 |
| Molecular Formula | C18H22NO2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (3-hydroxy-2-oxo-3,3-diphenylpropyl)-trimethylazanium |
| SMILES | C[N+](C)(C)CC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22NO2/c1-19(2,3)14-17(20)18(21,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,21H,14H2,1-3H3/q+1 |
| InChIKey | NPILTPCRUJCTNM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|