C19H28NO3+ — CID 3305805
(4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl)-bis(2-hydroxyethyl)azanium (PubChem CID 3305805) has the molecular formula C19H28NO3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is (4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl)-bis(2-hydroxyethyl)azanium.
| Compound Name | (4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl)-bis(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 3305805 |
| Molecular Formula | C19H28NO3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (4-cyclopentyl-4-hydroxy-4-phenylbut-2-ynyl)-bis(2-hydroxyethyl)azanium |
| SMILES | OCC[NH+](CC#CC(O)(c1ccccc1)C1CCCC1)CCO |
| InChI | InChI=1S/C19H27NO3/c21-15-13-20(14-16-22)12-6-11-19(23,18-9-4-5-10-18)17-7-2-1-3-8-17/h1-3,7-8,18,21-23H,4-5,9-10,12-16H2/p+1 |
| InChIKey | XAQXJZRVHJUEEH-UHFFFAOYSA-O |
| XLogP | -0.06 |
| TPSA | 65.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|