C19H25NO — CID 750153
(1R)-1-cyclopentyl-1-phenyl-4-pyrrolidin-1-ylbut-2-yn-1-ol (PubChem CID 750153) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-1-phenyl-4-pyrrolidin-1-ylbut-2-yn-1-ol.
| Compound Name | (1R)-1-cyclopentyl-1-phenyl-4-pyrrolidin-1-ylbut-2-yn-1-ol |
|---|---|
| PubChem CID | 750153 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (1R)-1-cyclopentyl-1-phenyl-4-pyrrolidin-1-ylbut-2-yn-1-ol |
| SMILES | O[C@@](C#CCN1CCCC1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H25NO/c21-19(18-11-4-5-12-18,17-9-2-1-3-10-17)13-8-16-20-14-6-7-15-20/h1-3,9-10,18,21H,4-7,11-12,14-16H2/t19-/m0/s1 |
| InChIKey | AVWNFUAIXNOOSJ-IBGZPJMESA-N |
| XLogP | 3.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|