C16H26N2O3 — CID 60994370
2-[2-(diethylamino)ethylamino]-2-(4-methoxyphenyl)propanoic acid (PubChem CID 60994370) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-2-(4-methoxyphenyl)propanoic acid.
| Compound Name | 2-[2-(diethylamino)ethylamino]-2-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 60994370 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-2-(4-methoxyphenyl)propanoic acid |
| SMILES | CCN(CC)CCNC(C)(C(=O)O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-18(6-2)12-11-17-16(3,15(19)20)13-7-9-14(21-4)10-8-13/h7-10,17H,5-6,11-12H2,1-4H3,(H,19,20) |
| InChIKey | YDCFAYBGNWXFLO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |