C13H14Cl3NO5 — CID 169081160
(2S)-2-(4-methoxyphenyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid (PubChem CID 169081160) has the molecular formula C13H14Cl3NO5 and a molecular weight of 370.62 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-2-(4-methoxyphenyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 169081160 |
| Molecular Formula | C13H14Cl3NO5 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid |
| SMILES | COc1ccc([C@](C)(NC(=O)OCC(Cl)(Cl)Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C13H14Cl3NO5/c1-12(10(18)19,8-3-5-9(21-2)6-4-8)17-11(20)22-7-13(14,15)16/h3-6H,7H2,1-2H3,(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | PQKNCLGKFIVQQV-LBPRGKRZSA-N |
| XLogP | 3.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|