C30H30N4O2 — CID 174828822
2,2-bis(4-anilinophenyl)hexanediamide (PubChem CID 174828822) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2,2-bis(4-anilinophenyl)hexanediamide.
| Compound Name | 2,2-bis(4-anilinophenyl)hexanediamide |
|---|---|
| PubChem CID | 174828822 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2,2-bis(4-anilinophenyl)hexanediamide |
| SMILES | NC(=O)CCCC(C(N)=O)(c1ccc(Nc2ccccc2)cc1)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N4O2/c31-28(35)12-7-21-30(29(32)36,22-13-17-26(18-14-22)33-24-8-3-1-4-9-24)23-15-19-27(20-16-23)34-25-10-5-2-6-11-25/h1-6,8-11,13-20,33-34H,7,12,21H2,(H2,31,35)(H2,32,36) |
| InChIKey | KPHARFDNSCBUTN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |