C14H20F3N3O — CID 116693883
2-amino-4-[methyl(3,3,3-trifluoropropyl)amino]-2-phenylbutanamide (PubChem CID 116693883) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-amino-4-[methyl(3,3,3-trifluoropropyl)amino]-2-phenylbutanamide.
| Compound Name | 2-amino-4-[methyl(3,3,3-trifluoropropyl)amino]-2-phenylbutanamide |
|---|---|
| PubChem CID | 116693883 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-amino-4-[methyl(3,3,3-trifluoropropyl)amino]-2-phenylbutanamide |
| SMILES | CN(CCC(F)(F)F)CCC(N)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C14H20F3N3O/c1-20(10-8-14(15,16)17)9-7-13(19,12(18)21)11-5-3-2-4-6-11/h2-6H,7-10,19H2,1H3,(H2,18,21) |
| InChIKey | LERPENVTKBULOR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |