C25H37BrN2O — CID 3026428
(4-amino-4-oxo-3,3-diphenylbutyl)-tri(propan-2-yl)azanium bromide (PubChem CID 3026428) has the molecular formula C25H37BrN2O and a molecular weight of 461.49 g/mol. Its IUPAC name is (4-amino-4-oxo-3,3-diphenylbutyl)-tri(propan-2-yl)azanium bromide.
| Compound Name | (4-amino-4-oxo-3,3-diphenylbutyl)-tri(propan-2-yl)azanium bromide |
|---|---|
| PubChem CID | 3026428 |
| Molecular Formula | C25H37BrN2O |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (4-amino-4-oxo-3,3-diphenylbutyl)-tri(propan-2-yl)azanium bromide |
| SMILES | CC(C)[N+](CCC(C(N)=O)(c1ccccc1)c1ccccc1)(C(C)C)C(C)C.[Br-] |
| InChI | InChI=1S/C25H36N2O.BrH/c1-19(2)27(20(3)4,21(5)6)18-17-25(24(26)28,22-13-9-7-10-14-22)23-15-11-8-12-16-23;/h7-16,19-21H,17-18H2,1-6H3,(H-,26,28);1H |
| InChIKey | ZCBASYJLWAXCJC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|