C15H22BrN — CID 157213968
1-methyl-1-(2-phenylprop-2-enyl)piperidin-1-ium bromide (PubChem CID 157213968) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 1-methyl-1-(2-phenylprop-2-enyl)piperidin-1-ium bromide.
| Compound Name | 1-methyl-1-(2-phenylprop-2-enyl)piperidin-1-ium bromide |
|---|---|
| PubChem CID | 157213968 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-methyl-1-(2-phenylprop-2-enyl)piperidin-1-ium bromide |
| SMILES | C=C(C[N+]1(C)CCCCC1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C15H22N.BrH/c1-14(15-9-5-3-6-10-15)13-16(2)11-7-4-8-12-16;/h3,5-6,9-10H,1,4,7-8,11-13H2,2H3;1H/q+1;/p-1 |
| InChIKey | LWLBXOKYKOKZBW-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|