C22H26ClNO — CID 132899157
4-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol chloride (PubChem CID 132899157) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is 4-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol chloride.
| Compound Name | 4-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol chloride |
|---|---|
| PubChem CID | 132899157 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-(1-methylpiperidin-1-ium-1-yl)-1,1-diphenylbut-2-yn-1-ol chloride |
| SMILES | C[N+]1(CC#CC(O)(c2ccccc2)c2ccccc2)CCCCC1.[Cl-] |
| InChI | InChI=1S/C22H26NO.ClH/c1-23(17-9-4-10-18-23)19-11-16-22(24,20-12-5-2-6-13-20)21-14-7-3-8-15-21;/h2-3,5-8,12-15,24H,4,9-10,17-19H2,1H3;1H/q+1;/p-1 |
| InChIKey | VUVHYIFBTRSQCP-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|